C20H22N3O+ — CID 101194249
4,5-diethyl-15-methoxy-17-methyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 101194249) has the molecular formula C20H22N3O+ and a molecular weight of 320.42 g/mol. Its IUPAC name is 4,5-diethyl-15-methoxy-17-methyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 4,5-diethyl-15-methoxy-17-methyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 101194249 |
| Molecular Formula | C20H22N3O+ |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4,5-diethyl-15-methoxy-17-methyl-6,17-diaza-7-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | CCc1cc2c3c(cc[n+]2nc1CC)c1cccc(OC)c1n3C |
| InChI | InChI=1S/C20H22N3O/c1-5-13-12-17-19-15(10-11-23(17)21-16(13)6-2)14-8-7-9-18(24-4)20(14)22(19)3/h7-12H,5-6H2,1-4H3/q+1 |
| InChIKey | GAZPFMNEUULXBB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|