C29H42 — CID 101194552
9,9-bis[(5S)-5-methylheptyl]fluorene (PubChem CID 101194552) has the molecular formula C29H42 and a molecular weight of 390.66 g/mol. Its IUPAC name is 9,9-bis[(5S)-5-methylheptyl]fluorene.
| Compound Name | 9,9-bis[(5S)-5-methylheptyl]fluorene |
|---|---|
| PubChem CID | 101194552 |
| Molecular Formula | C29H42 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | 9,9-bis[(5S)-5-methylheptyl]fluorene |
| SMILES | CC[C@H](C)CCCCC1(CCCC[C@@H](C)CC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H42/c1-5-23(3)15-11-13-21-29(22-14-12-16-24(4)6-2)27-19-9-7-17-25(27)26-18-8-10-20-28(26)29/h7-10,17-20,23-24H,5-6,11-16,21-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | XRXDEAYZQQIJEM-ZEQRLZLVSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|