C19H27NO4 — CID 101194893
tert-butyl (E)-3-[(3-ethoxy-3-oxo-1-phenylpropyl)amino]but-2-enoate (PubChem CID 101194893) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl (E)-3-[(3-ethoxy-3-oxo-1-phenylpropyl)amino]but-2-enoate.
| Compound Name | tert-butyl (E)-3-[(3-ethoxy-3-oxo-1-phenylpropyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 101194893 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl (E)-3-[(3-ethoxy-3-oxo-1-phenylpropyl)amino]but-2-enoate |
| SMILES | CCOC(=O)CC(N/C(C)=C/C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c1-6-23-17(21)13-16(15-10-8-7-9-11-15)20-14(2)12-18(22)24-19(3,4)5/h7-12,16,20H,6,13H2,1-5H3/b14-12+ |
| InChIKey | RWPSWCSFJDTZHC-WYMLVPIESA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|