C23H26N4O2S — CID 101195058
1-[6-benzylsulfanyl-9-(oxan-2-yl)purin-2-yl]-3-methylpent-1-yn-3-ol (PubChem CID 101195058) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[6-benzylsulfanyl-9-(oxan-2-yl)purin-2-yl]-3-methylpent-1-yn-3-ol.
| Compound Name | 1-[6-benzylsulfanyl-9-(oxan-2-yl)purin-2-yl]-3-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 101195058 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[6-benzylsulfanyl-9-(oxan-2-yl)purin-2-yl]-3-methylpent-1-yn-3-ol |
| SMILES | CCC(C)(O)C#Cc1nc(SCc2ccccc2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C23H26N4O2S/c1-3-23(2,28)13-12-18-25-21-20(24-16-27(21)19-11-7-8-14-29-19)22(26-18)30-15-17-9-5-4-6-10-17/h4-6,9-10,16,19,28H,3,7-8,11,14-15H2,1-2H3 |
| InChIKey | XXTXUUQYQYFCIZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|