C20H28N2O10 — CID 101195098
(2R,4S,5R,6R)-5-acetamido-2-[2-(benzylamino)-2-oxoethoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 101195098) has the molecular formula C20H28N2O10 and a molecular weight of 456.45 g/mol. Its IUPAC name is (2R,4S,5R,6R)-5-acetamido-2-[2-(benzylamino)-2-oxoethoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-5-acetamido-2-[2-(benzylamino)-2-oxoethoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 101195098 |
| Molecular Formula | C20H28N2O10 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2R,4S,5R,6R)-5-acetamido-2-[2-(benzylamino)-2-oxoethoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@](OCC(=O)NCc2ccccc2)(C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C20H28N2O10/c1-11(24)22-16-13(25)7-20(19(29)30,32-18(16)17(28)14(26)9-23)31-10-15(27)21-8-12-5-3-2-4-6-12/h2-6,13-14,16-18,23,25-26,28H,7-10H2,1H3,(H,21,27)(H,22,24)(H,29,30)/t13-,14+,16+,17+,18+,20+/m0/s1 |
| InChIKey | FTDZBLDRJUASQN-WAAZTVICSA-N |
| XLogP | -2.53 |
| TPSA | 194.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |