C31H35F3N4O — CID 10119513
N,N-diethyl-4-[C-[4-(2-phenylethyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]carbonimidoyl]benzamide (PubChem CID 10119513) has the molecular formula C31H35F3N4O and a molecular weight of 536.64 g/mol. Its IUPAC name is N,N-diethyl-4-[C-[4-(2-phenylethyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]carbonimidoyl]benzamide.
| Compound Name | N,N-diethyl-4-[C-[4-(2-phenylethyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 10119513 |
| Molecular Formula | C31H35F3N4O |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | N,N-diethyl-4-[C-[4-(2-phenylethyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]carbonimidoyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(/C(=N/c2ccccc2C(F)(F)F)N2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H35F3N4O/c1-3-37(4-2)30(39)26-16-14-25(15-17-26)29(35-28-13-9-8-12-27(28)31(32,33)34)38-22-20-36(21-23-38)19-18-24-10-6-5-7-11-24/h5-17H,3-4,18-23H2,1-2H3/b35-29- |
| InChIKey | MFBRLBRAUDQILR-MJPNWULPSA-N |
| XLogP | 6.13 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|