C20H28O4 — CID 101195770
(3aR,5aS,8S,10aR,10bS)-8-hydroperoxy-3a,5a,8-trimethyl-1-propan-2-yl-9,10,10a,10b-tetrahydro-5H-cyclohepta[e]indene-3,4-dione (PubChem CID 101195770) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3aR,5aS,8S,10aR,10bS)-8-hydroperoxy-3a,5a,8-trimethyl-1-propan-2-yl-9,10,10a,10b-tetrahydro-5H-cyclohepta[e]indene-3,4-dione.
| Compound Name | (3aR,5aS,8S,10aR,10bS)-8-hydroperoxy-3a,5a,8-trimethyl-1-propan-2-yl-9,10,10a,10b-tetrahydro-5H-cyclohepta[e]indene-3,4-dione |
|---|---|
| PubChem CID | 101195770 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3aR,5aS,8S,10aR,10bS)-8-hydroperoxy-3a,5a,8-trimethyl-1-propan-2-yl-9,10,10a,10b-tetrahydro-5H-cyclohepta[e]indene-3,4-dione |
| SMILES | CC(C)C1=CC(=O)[C@@]2(C)C(=O)C[C@@]3(C)C=C[C@@](C)(OO)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-12(2)13-10-15(21)20(5)16(22)11-18(3)8-9-19(4,24-23)7-6-14(18)17(13)20/h8-10,12,14,17,23H,6-7,11H2,1-5H3/t14-,17-,18-,19+,20+/m1/s1 |
| InChIKey | CPODEQZHKQZZTP-SBUWESJJSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|