C15H20O6 — CID 101196016
(1S,4R,7R)-7-acetyl-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one (PubChem CID 101196016) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1S,4R,7R)-7-acetyl-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4R,7R)-7-acetyl-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 101196016 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1S,4R,7R)-7-acetyl-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(C3OCCO3)[C@H]1C[C@H]2C(C)=O |
| InChI | InChI=1S/C15H20O6/c1-8(16)9-7-12-11(14-20-4-5-21-14)6-10(9)13(17)15(12,18-2)19-3/h6,9-10,12,14H,4-5,7H2,1-3H3/t9-,10-,12+/m0/s1 |
| InChIKey | YOQZUJNIZOYWKP-JBLDHEPKSA-N |
| XLogP | 0.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|