C14H19BrO5 — CID 101196026
methyl (1R,2R,4S)-5-bromo-8,8-dimethoxy-2,6-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 101196026) has the molecular formula C14H19BrO5 and a molecular weight of 347.21 g/mol. Its IUPAC name is methyl (1R,2R,4S)-5-bromo-8,8-dimethoxy-2,6-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2R,4S)-5-bromo-8,8-dimethoxy-2,6-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101196026 |
| Molecular Formula | C14H19BrO5 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | methyl (1R,2R,4S)-5-bromo-8,8-dimethoxy-2,6-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)C[C@@H]2C(Br)=C(C)[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C14H19BrO5/c1-7-9-11(16)14(19-4,20-5)8(10(7)15)6-13(9,2)12(17)18-3/h8-9H,6H2,1-5H3/t8-,9-,13-/m1/s1 |
| InChIKey | UXQFMEWARCYJHG-JRKPZEMJSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|