C15H19BrO6 — CID 101196034
(1S,4R,7R)-7-acetyl-6-bromo-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one (PubChem CID 101196034) has the molecular formula C15H19BrO6 and a molecular weight of 375.22 g/mol. Its IUPAC name is (1S,4R,7R)-7-acetyl-6-bromo-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4R,7R)-7-acetyl-6-bromo-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 101196034 |
| Molecular Formula | C15H19BrO6 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (1S,4R,7R)-7-acetyl-6-bromo-5-(1,3-dioxolan-2-yl)-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C(Br)=C(C3OCCO3)[C@H]1C[C@H]2C(C)=O |
| InChI | InChI=1S/C15H19BrO6/c1-7(17)8-6-9-11(14-21-4-5-22-14)12(16)10(8)13(18)15(9,19-2)20-3/h8-10,14H,4-6H2,1-3H3/t8-,9+,10+/m0/s1 |
| InChIKey | HNGUQIPLPCBBOS-IVZWLZJFSA-N |
| XLogP | 1.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|