C24H28Cl2N4O2S2 — CID 10119624
4-[4-[5-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazol-2-yl]butyl]-N,N-dimethylaniline (PubChem CID 10119624) has the molecular formula C24H28Cl2N4O2S2 and a molecular weight of 539.55 g/mol. Its IUPAC name is 4-[4-[5-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazol-2-yl]butyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[5-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazol-2-yl]butyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10119624 |
| Molecular Formula | C24H28Cl2N4O2S2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 4-[4-[5-[1-(3,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3,4-thiadiazol-2-yl]butyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CCCCc2nnc(C3CCCN3S(=O)(=O)c3ccc(Cl)c(Cl)c3)s2)cc1 |
| InChI | InChI=1S/C24H28Cl2N4O2S2/c1-29(2)18-11-9-17(10-12-18)6-3-4-8-23-27-28-24(33-23)22-7-5-15-30(22)34(31,32)19-13-14-20(25)21(26)16-19/h9-14,16,22H,3-8,15H2,1-2H3 |
| InChIKey | UTBJKGNQMYEKNY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|