C28H41N3O4 — CID 101196288
6,7-dimethoxy-2-methyl-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide (PubChem CID 101196288) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide.
| Compound Name | 6,7-dimethoxy-2-methyl-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 101196288 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide |
| SMILES | COc1ccc2c(C(=O)N[C@@H]3C(C)(C)[C@@H]4CC[C@@]3(C)C4)c(C)n(CCN3CCOCC3)c2c1OC |
| InChI | InChI=1S/C28H41N3O4/c1-18-22(25(32)29-26-27(2,3)19-9-10-28(26,4)17-19)20-7-8-21(33-5)24(34-6)23(20)31(18)12-11-30-13-15-35-16-14-30/h7-8,19,26H,9-17H2,1-6H3,(H,29,32)/t19-,26-,28+/m1/s1 |
| InChIKey | NKDCWAQDGIHANV-YPLOMLCWSA-N |
| XLogP | 4.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |