C17H20O2S — CID 101196318
2',2',3,4-tetramethylspiro[2,5-dihydrothiopyran-6,3'-chromene]-4'-one (PubChem CID 101196318) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 2',2',3,4-tetramethylspiro[2,5-dihydrothiopyran-6,3'-chromene]-4'-one.
| Compound Name | 2',2',3,4-tetramethylspiro[2,5-dihydrothiopyran-6,3'-chromene]-4'-one |
|---|---|
| PubChem CID | 101196318 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2',2',3,4-tetramethylspiro[2,5-dihydrothiopyran-6,3'-chromene]-4'-one |
| SMILES | CC1=C(C)CC2(SC1)C(=O)c1ccccc1OC2(C)C |
| InChI | InChI=1S/C17H20O2S/c1-11-9-17(20-10-12(11)2)15(18)13-7-5-6-8-14(13)19-16(17,3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | ZNKBXSWRXPKPEY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|