C24H27NO4S — CID 101196574
methyl (Z)-4-[6-methyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylbut-3-enoate (PubChem CID 101196574) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is methyl (Z)-4-[6-methyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylbut-3-enoate.
| Compound Name | methyl (Z)-4-[6-methyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylbut-3-enoate |
|---|---|
| PubChem CID | 101196574 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | methyl (Z)-4-[6-methyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]-3-phenylbut-3-enoate |
| SMILES | COC(=O)C/C(=C/C1C=CC(C)N(S(=O)(=O)c2ccc(C)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO4S/c1-18-9-13-23(14-10-18)30(27,28)25-17-20(12-11-19(25)2)15-22(16-24(26)29-3)21-7-5-4-6-8-21/h4-15,19-20H,16-17H2,1-3H3/b22-15- |
| InChIKey | OAZFMHNWHROESA-JCMHNJIXSA-N |
| XLogP | 4.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|