C12H15NO — CID 101197364
(2R)-2-(2-methylphenyl)pent-4-enamide (PubChem CID 101197364) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (2R)-2-(2-methylphenyl)pent-4-enamide.
| Compound Name | (2R)-2-(2-methylphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 101197364 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2R)-2-(2-methylphenyl)pent-4-enamide |
| SMILES | C=CC[C@@H](C(N)=O)c1ccccc1C |
| InChI | InChI=1S/C12H15NO/c1-3-6-11(12(13)14)10-8-5-4-7-9(10)2/h3-5,7-8,11H,1,6H2,2H3,(H2,13,14)/t11-/m1/s1 |
| InChIKey | WKZPOZBGCSEWIO-LLVKDONJSA-N |
| XLogP | 2.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|