C11H13F3O2 — CID 101197381
2,2,2-trifluoroethyl (1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101197381) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101197381 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2,2,2-trifluoroethyl (1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OCC(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H13F3O2/c1-6-7-2-3-8(4-7)9(6)10(15)16-5-11(12,13)14/h2-3,6-9H,4-5H2,1H3/t6-,7+,8-,9+/m0/s1 |
| InChIKey | OLULPLJSCRMFOH-UYXSQOIJSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|