C17H27NO — CID 101197441
1,1,3,3-tetramethyl-2-(2-methylbutan-2-yloxy)isoindole (PubChem CID 101197441) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-methylbutan-2-yloxy)isoindole.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-methylbutan-2-yloxy)isoindole |
|---|---|
| PubChem CID | 101197441 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-methylbutan-2-yloxy)isoindole |
| SMILES | CCC(C)(C)ON1C(C)(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H27NO/c1-8-15(2,3)19-18-16(4,5)13-11-9-10-12-14(13)17(18,6)7/h9-12H,8H2,1-7H3 |
| InChIKey | UMWVDLBHEIFILN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |