C18H19BrF3NO6Se — CID 101197631
[(2S,3S,4R,5R,6R)-4-acetyloxy-6-bromo-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 101197631) has the molecular formula C18H19BrF3NO6Se and a molecular weight of 561.21 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-4-acetyloxy-6-bromo-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-4-acetyloxy-6-bromo-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101197631 |
| Molecular Formula | C18H19BrF3NO6Se |
| Molecular Weight | 561.21 g/mol |
| Exact Mass | 560.95 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-4-acetyloxy-6-bromo-2-(phenylselanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](NC(=O)C(F)(F)F)[C@@H](Br)O[C@H](C[Se]c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19BrF3NO6Se/c1-9(24)27-14-12(8-30-11-6-4-3-5-7-11)29-16(19)13(15(14)28-10(2)25)23-17(26)18(20,21)22/h3-7,12-16H,8H2,1-2H3,(H,23,26)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | ZQOCSDUHFXXGEJ-QCODTGAPSA-N |
| XLogP | 1.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|