About (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one
(6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one (PubChem CID 101197720) has the molecular formula C22H16F2O2
and a molecular weight of 350.36 g/mol. Its IUPAC name is (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 101197720 |
| Molecular Formula | C22H16F2O2 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=C/C(=C\C=C(c2ccc(F)cc2)c2ccc(F)cc2)C(=O)C=C1 |
| InChI | InChI=1S/C22H16F2O2/c1-26-20-11-13-22(25)17(14-20)6-12-21(15-2-7-18(23)8-3-15)16-4-9-19(24)10-5-16/h2-14H,1H3/b17-6+ |
| InChIKey | FNUAFCHIODOKNA-UBKPWBPPSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one?
The IUPAC name of (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one (CID 101197720) is (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one is COC1=C/C(=C\C=C(c2ccc(F)cc2)c2ccc(F)cc2)C(=O)C=C1.
What is the InChIKey of (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one?
The InChIKey is FNUAFCHIODOKNA-UBKPWBPPSA-N. The full InChI is InChI=1S/C22H16F2O2/c1-26-20-11-13-22(25)17(14-20)6-12-21(15-2-7-18(23)8-3-15)16-4-9-19(24)10-5-16/h2-14H,1H3/b17-6+.
What are the key properties of (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one?
(6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one has a molecular weight of 350.36 g/mol, XLogP of 4.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[3,3-bis(4-fluorophenyl)prop-2-enylidene]-4-methoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 101197720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).