C22H38O2Si — CID 101197986
(1R,5S,7R,9S,13R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyltricyclo[7.4.1.01,5]tetradec-10-en-14-one (PubChem CID 101197986) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (1R,5S,7R,9S,13R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyltricyclo[7.4.1.01,5]tetradec-10-en-14-one.
| Compound Name | (1R,5S,7R,9S,13R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyltricyclo[7.4.1.01,5]tetradec-10-en-14-one |
|---|---|
| PubChem CID | 101197986 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1R,5S,7R,9S,13R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyltricyclo[7.4.1.01,5]tetradec-10-en-14-one |
| SMILES | C[C@@H]1CC=C[C@@H]2C[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H]3CCC[C@]31C2=O |
| InChI | InChI=1S/C22H38O2Si/c1-16-9-7-10-18-13-17(15-24-25(5,6)21(2,3)4)14-19-11-8-12-22(16,19)20(18)23/h7,10,16-19H,8-9,11-15H2,1-6H3/t16-,17+,18-,19+,22-/m1/s1 |
| InChIKey | MQGFOULMTRJZAB-GOYZHWMFSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|