About 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane
2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101198086) has the molecular formula C18H32O2Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane |
| PubChem CID | 101198086 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCO[C@@H]1CC=C[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C18H32O2Si/c1-8-19-18-11-9-10-17(20-18)12-13-21(14(2)3,15(4)5)16(6)7/h9-10,14-18H,8,11H2,1-7H3/t17-,18-/m0/s1 |
| InChIKey | PFVUTDSFEHOHBO-ROUUACIJSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane?
The IUPAC name of 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane (CID 101198086) is 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane.
What is the SMILES notation for 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane?
The canonical SMILES for 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane is CCO[C@@H]1CC=C[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O1.
What is the InChIKey of 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane?
The InChIKey is PFVUTDSFEHOHBO-ROUUACIJSA-N. The full InChI is InChI=1S/C18H32O2Si/c1-8-19-18-11-9-10-17(20-18)12-13-21(14(2)3,15(4)5)16(6)7/h9-10,14-18H,8,11H2,1-7H3/t17-,18-/m0/s1.
What are the key properties of 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane?
2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane has a molecular weight of 308.54 g/mol, XLogP of 4.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,6S)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]ethynyl-tri(propan-2-yl)silane is sourced from PubChem (CID 101198086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).