C11H7FN4O — CID 101198119
4-fluoro-5-methoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 101198119) has the molecular formula C11H7FN4O and a molecular weight of 230.20 g/mol. Its IUPAC name is 4-fluoro-5-methoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 4-fluoro-5-methoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 101198119 |
| Molecular Formula | C11H7FN4O |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-fluoro-5-methoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | COC1=C(F)CC(C#N)(C#N)C(C#N)(C#N)C1 |
| InChI | InChI=1S/C11H7FN4O/c1-17-9-3-11(6-15,7-16)10(4-13,5-14)2-8(9)12/h2-3H2,1H3 |
| InChIKey | OZMGPWUEBORJFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|