About (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one
(3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one (PubChem CID 101198190) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one.
Molecular Properties
| Compound Name | (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one |
| PubChem CID | 101198190 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one |
| SMILES | CCCC[C@@H]1C(=O)ON(Cc2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/C17H25NO2/c1-4-5-11-15-16(13(2)3)18(20-17(15)19)12-14-9-7-6-8-10-14/h6-10,13,15-16H,4-5,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | FXJRWORYKUHINK-JKSUJKDBSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one?
The IUPAC name of (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one (CID 101198190) is (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one.
What is the SMILES notation for (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one?
The canonical SMILES for (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one is CCCC[C@@H]1C(=O)ON(Cc2ccccc2)[C@@H]1C(C)C.
What is the InChIKey of (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one?
The InChIKey is FXJRWORYKUHINK-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H25NO2/c1-4-5-11-15-16(13(2)3)18(20-17(15)19)12-14-9-7-6-8-10-14/h6-10,13,15-16H,4-5,11-12H2,1-3H3/t15-,16+/m0/s1.
What are the key properties of (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one?
(3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one has a molecular weight of 275.39 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-2-benzyl-4-butyl-3-propan-2-yl-1,2-oxazolidin-5-one is sourced from PubChem (CID 101198190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).