C20H30O2 — CID 101198513
[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.2]oct-5-enyl]methanone (PubChem CID 101198513) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.2]oct-5-enyl]methanone.
| Compound Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.2]oct-5-enyl]methanone |
|---|---|
| PubChem CID | 101198513 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.2]oct-5-enyl]methanone |
| SMILES | C[C@@H]1[C@@H](C(=O)[C@@]2(O)C[C@H]3CC[C@]2(C)C3(C)C)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C20H30O2/c1-12-13-5-7-14(8-6-13)16(12)17(21)20(22)11-15-9-10-19(20,4)18(15,2)3/h5,7,12-16,22H,6,8-11H2,1-4H3/t12-,13+,14-,15+,16+,19+,20-/m0/s1 |
| InChIKey | TYRSBMUVVRBLNI-AKGTUPFUSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|