C24H30O2 — CID 101198515
[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]methanone (PubChem CID 101198515) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]methanone.
| Compound Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]methanone |
|---|---|
| PubChem CID | 101198515 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]methanone |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(C(=O)[C@@H]1[C@@H](c3ccccc3)[C@@H]3C=C[C@H]1C3)C2 |
| InChI | InChI=1S/C24H30O2/c1-22(2)18-11-12-23(22,3)24(26,14-18)21(25)20-17-10-9-16(13-17)19(20)15-7-5-4-6-8-15/h4-10,16-20,26H,11-14H2,1-3H3/t16-,17+,18-,19+,20+,23-,24+/m1/s1 |
| InChIKey | JLQJGPWYHQGQTE-REBJYWLASA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|