About (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile
(E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile (PubChem CID 101198616) has the molecular formula C26H42N2Si2
and a molecular weight of 438.81 g/mol. Its IUPAC name is (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile.
Molecular Properties
| Compound Name | (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile |
| PubChem CID | 101198616 |
| Molecular Formula | C26H42N2Si2 |
| Molecular Weight | 438.81 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile |
| SMILES | CC(C)[Si](C#C/C(C#N)=C(\C#N)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H42N2Si2/c1-19(2)29(20(3)4,21(5)6)15-13-25(17-27)26(18-28)14-16-30(22(7)8,23(9)10)24(11)12/h19-24H,1-12H3/b26-25+ |
| InChIKey | ALKIBYFSPVHDIA-OCEACIFDSA-N |
| XLogP | 7.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile?
The IUPAC name of (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile (CID 101198616) is (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile.
What is the SMILES notation for (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile?
The canonical SMILES for (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile is CC(C)[Si](C#C/C(C#N)=C(\C#N)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile?
The InChIKey is ALKIBYFSPVHDIA-OCEACIFDSA-N. The full InChI is InChI=1S/C26H42N2Si2/c1-19(2)29(20(3)4,21(5)6)15-13-25(17-27)26(18-28)14-16-30(22(7)8,23(9)10)24(11)12/h19-24H,1-12H3/b26-25+.
What are the key properties of (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile?
(E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile has a molecular weight of 438.81 g/mol, XLogP of 7.77, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis[2-tri(propan-2-yl)silylethynyl]but-2-enedinitrile is sourced from PubChem (CID 101198616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).