C54H84N2Si4 — CID 101198623
(2Z,8Z)-2,3,8,9-tetrakis[2-tri(propan-2-yl)silylethynyl]deca-2,8-dien-4,6-diynedinitrile (PubChem CID 101198623) has the molecular formula C54H84N2Si4 and a molecular weight of 873.62 g/mol. Its IUPAC name is (2Z,8Z)-2,3,8,9-tetrakis[2-tri(propan-2-yl)silylethynyl]deca-2,8-dien-4,6-diynedinitrile.
| Compound Name | (2Z,8Z)-2,3,8,9-tetrakis[2-tri(propan-2-yl)silylethynyl]deca-2,8-dien-4,6-diynedinitrile |
|---|---|
| PubChem CID | 101198623 |
| Molecular Formula | C54H84N2Si4 |
| Molecular Weight | 873.62 g/mol |
| Exact Mass | 872.57 |
| IUPAC Name | (2Z,8Z)-2,3,8,9-tetrakis[2-tri(propan-2-yl)silylethynyl]deca-2,8-dien-4,6-diynedinitrile |
| SMILES | CC(C)[Si](C#C/C(C#N)=C(\C#CC#C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(/C#N)C#C[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C54H84N2Si4/c1-39(2)57(40(3)4,41(5)6)33-29-51(53(37-55)31-35-59(45(13)14,46(15)16)47(17)18)27-25-26-28-52(30-34-58(42(7)8,43(9)10)44(11)12)54(38-56)32-36-60(48(19)20,49(21)22)50(23)24/h39-50H,1-24H3/b53-51-,54-52- |
| InChIKey | FZKASGMJVATHIP-XXMGNTHJSA-N |
| XLogP | 15.52 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.62 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|