C24H46NO6PSi — CID 101199564
N-[(1S,2S,6R)-4-diethoxyphosphoryl-6-prop-2-enoxy-2-tri(propan-2-yl)silyloxycyclohex-3-en-1-yl]acetamide (PubChem CID 101199564) has the molecular formula C24H46NO6PSi and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[(1S,2S,6R)-4-diethoxyphosphoryl-6-prop-2-enoxy-2-tri(propan-2-yl)silyloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1S,2S,6R)-4-diethoxyphosphoryl-6-prop-2-enoxy-2-tri(propan-2-yl)silyloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101199564 |
| Molecular Formula | C24H46NO6PSi |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-[(1S,2S,6R)-4-diethoxyphosphoryl-6-prop-2-enoxy-2-tri(propan-2-yl)silyloxycyclohex-3-en-1-yl]acetamide |
| SMILES | C=CCO[C@@H]1CC(P(=O)(OCC)OCC)=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C24H46NO6PSi/c1-11-14-28-22-15-21(32(27,29-12-2)30-13-3)16-23(24(22)25-20(10)26)31-33(17(4)5,18(6)7)19(8)9/h11,16-19,22-24H,1,12-15H2,2-10H3,(H,25,26)/t22-,23+,24+/m1/s1 |
| InChIKey | ZQSLAHKVZGADCE-SGNDLWITSA-N |
| XLogP | 6.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|