C12H22O3Si — CID 101199759
2-[(Z)-but-2-enyl]-2-ethenoxy-4,4,5,5-tetramethyl-1,3,2-dioxasilolane (PubChem CID 101199759) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-2-ethenoxy-4,4,5,5-tetramethyl-1,3,2-dioxasilolane.
| Compound Name | 2-[(Z)-but-2-enyl]-2-ethenoxy-4,4,5,5-tetramethyl-1,3,2-dioxasilolane |
|---|---|
| PubChem CID | 101199759 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-2-ethenoxy-4,4,5,5-tetramethyl-1,3,2-dioxasilolane |
| SMILES | C=CO[Si]1(C/C=C\C)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H22O3Si/c1-7-9-10-16(13-8-2)14-11(3,4)12(5,6)15-16/h7-9H,2,10H2,1,3-6H3/b9-7- |
| InChIKey | JWMRUFCUSQRDEZ-CLFYSBASSA-N |
| XLogP | 3.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|