About 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane
1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane (PubChem CID 101199877) has the molecular formula C20H30N2Se
and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane.
Molecular Properties
| Compound Name | 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane |
| PubChem CID | 101199877 |
| Molecular Formula | C20H30N2Se |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane |
| SMILES | C1C2CC3CC1CC(N=[Se]=NC14CC5CC(CC(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C20H30N2Se/c1-13-2-15-3-14(1)8-19(7-13,9-15)21-23-22-20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2 |
| InChIKey | XMZHYFVLQJVEIV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane?
The IUPAC name of 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane (CID 101199877) is 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane.
What is the SMILES notation for 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane?
The canonical SMILES for 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane is C1C2CC3CC1CC(N=[Se]=NC14CC5CC(CC(C5)C1)C4)(C2)C3.
What is the InChIKey of 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane?
The InChIKey is XMZHYFVLQJVEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2Se/c1-13-2-15-3-14(1)8-19(7-13,9-15)21-23-22-20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2.
What are the key properties of 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane?
1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane has a molecular weight of 377.43 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-adamantylimino-λ4-selanylidene)amino]adamantane is sourced from PubChem (CID 101199877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).