About dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane
dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane (PubChem CID 101200127) has the molecular formula C26H41BO2
and a molecular weight of 396.42 g/mol. Its IUPAC name is dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane.
Molecular Properties
| Compound Name | dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane |
| PubChem CID | 101200127 |
| Molecular Formula | C26H41BO2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane |
| SMILES | C=C(OB(C1CCCCC1)C1CCCCC1)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C26H41BO2/c1-19(2)24-17-12-18-25(20(3)4)26(24)28-21(5)29-27(22-13-8-6-9-14-22)23-15-10-7-11-16-23/h12,17-20,22-23H,5-11,13-16H2,1-4H3 |
| InChIKey | CCXRUXFYMUUKTJ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane?
The IUPAC name of dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane (CID 101200127) is dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane.
What is the SMILES notation for dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane?
The canonical SMILES for dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane is C=C(OB(C1CCCCC1)C1CCCCC1)Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane?
The InChIKey is CCXRUXFYMUUKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H41BO2/c1-19(2)24-17-12-18-25(20(3)4)26(24)28-21(5)29-27(22-13-8-6-9-14-22)23-15-10-7-11-16-23/h12,17-20,22-23H,5-11,13-16H2,1-4H3.
What are the key properties of dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane?
dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane has a molecular weight of 396.42 g/mol, XLogP of 8.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl-[1-[2,6-di(propan-2-yl)phenoxy]ethenoxy]borane is sourced from PubChem (CID 101200127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).