About 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione
6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione (PubChem CID 101200163) has the molecular formula C10H13BrN2O4
and a molecular weight of 305.13 g/mol. Its IUPAC name is 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione |
| PubChem CID | 101200163 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione |
| SMILES | COCn1c(/C=C/Br)cc(=O)n(COC)c1=O |
| InChI | InChI=1S/C10H13BrN2O4/c1-16-6-12-8(3-4-11)5-9(14)13(7-17-2)10(12)15/h3-5H,6-7H2,1-2H3/b4-3+ |
| InChIKey | LERWMGZUDCEOIN-ONEGZZNKSA-N |
| XLogP | 0.58 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The IUPAC name of 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione (CID 101200163) is 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The canonical SMILES for 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione is COCn1c(/C=C/Br)cc(=O)n(COC)c1=O.
What is the InChIKey of 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The InChIKey is LERWMGZUDCEOIN-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H13BrN2O4/c1-16-6-12-8(3-4-11)5-9(14)13(7-17-2)10(12)15/h3-5H,6-7H2,1-2H3/b4-3+.
What are the key properties of 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione has a molecular weight of 305.13 g/mol, XLogP of 0.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-bromoethenyl]-1,3-bis(methoxymethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 101200163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).