About methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate
methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate (PubChem CID 101200308) has the molecular formula C15H28O4Si
and a molecular weight of 300.47 g/mol. Its IUPAC name is methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate |
| PubChem CID | 101200308 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate |
| SMILES | COC(=O)/C=C(/OC)[C@@H]1C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O4Si/c1-15(2,3)20(6,7)19-10-11-8-12(11)13(17-4)9-14(16)18-5/h9,11-12H,8,10H2,1-7H3/b13-9+/t11-,12-/m1/s1 |
| InChIKey | BSPOJJDLEYALEG-AJGRILASSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate?
The IUPAC name of methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate (CID 101200308) is methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate.
What is the SMILES notation for methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate?
The canonical SMILES for methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate is COC(=O)/C=C(/OC)[C@@H]1C[C@@H]1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate?
The InChIKey is BSPOJJDLEYALEG-AJGRILASSA-N. The full InChI is InChI=1S/C15H28O4Si/c1-15(2,3)20(6,7)19-10-11-8-12(11)13(17-4)9-14(16)18-5/h9,11-12H,8,10H2,1-7H3/b13-9+/t11-,12-/m1/s1.
What are the key properties of methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate?
methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate has a molecular weight of 300.47 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-3-methoxyprop-2-enoate is sourced from PubChem (CID 101200308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).