About 6-N,5-dimethyl-1H-indazole-3,6-diamine
6-N,5-dimethyl-1H-indazole-3,6-diamine (PubChem CID 101200364) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-N,5-dimethyl-1H-indazole-3,6-diamine.
Molecular Properties
| Compound Name | 6-N,5-dimethyl-1H-indazole-3,6-diamine |
| PubChem CID | 101200364 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 6-N,5-dimethyl-1H-indazole-3,6-diamine |
| SMILES | CNc1cc2[nH]nc(N)c2cc1C |
| InChI | InChI=1S/C9H12N4/c1-5-3-6-8(4-7(5)11-2)12-13-9(6)10/h3-4,11H,1-2H3,(H3,10,12,13) |
| InChIKey | OZJODQBMSJSLKJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-N,5-dimethyl-1H-indazole-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,5-dimethyl-1H-indazole-3,6-diamine?
The IUPAC name of 6-N,5-dimethyl-1H-indazole-3,6-diamine (CID 101200364) is 6-N,5-dimethyl-1H-indazole-3,6-diamine.
What is the SMILES notation for 6-N,5-dimethyl-1H-indazole-3,6-diamine?
The canonical SMILES for 6-N,5-dimethyl-1H-indazole-3,6-diamine is CNc1cc2[nH]nc(N)c2cc1C.
What is the InChIKey of 6-N,5-dimethyl-1H-indazole-3,6-diamine?
The InChIKey is OZJODQBMSJSLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-5-3-6-8(4-7(5)11-2)12-13-9(6)10/h3-4,11H,1-2H3,(H3,10,12,13).
What are the key properties of 6-N,5-dimethyl-1H-indazole-3,6-diamine?
6-N,5-dimethyl-1H-indazole-3,6-diamine has a molecular weight of 176.22 g/mol, XLogP of 1.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,5-dimethyl-1H-indazole-3,6-diamine is sourced from PubChem (CID 101200364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).