C27H28N2O6 — CID 101201090
dimethyl 1'-[di(propan-2-yl)amino]-5',10-dioxospiro[anthracene-9,2'-pyrrole]-3',4'-dicarboxylate (PubChem CID 101201090) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is dimethyl 1'-[di(propan-2-yl)amino]-5',10-dioxospiro[anthracene-9,2'-pyrrole]-3',4'-dicarboxylate.
| Compound Name | dimethyl 1'-[di(propan-2-yl)amino]-5',10-dioxospiro[anthracene-9,2'-pyrrole]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 101201090 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | dimethyl 1'-[di(propan-2-yl)amino]-5',10-dioxospiro[anthracene-9,2'-pyrrole]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(c3ccccc3C(=O)c3ccccc32)N(N(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C27H28N2O6/c1-15(2)28(16(3)4)29-24(31)21(25(32)34-5)22(26(33)35-6)27(29)19-13-9-7-11-17(19)23(30)18-12-8-10-14-20(18)27/h7-16H,1-6H3 |
| InChIKey | YXZFHZWZKQXJFA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|