C14H28OSi — CID 101201262
(4,4-dimethylcyclohexen-1-yl)oxy-triethylsilane (PubChem CID 101201262) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is (4,4-dimethylcyclohexen-1-yl)oxy-triethylsilane.
| Compound Name | (4,4-dimethylcyclohexen-1-yl)oxy-triethylsilane |
|---|---|
| PubChem CID | 101201262 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (4,4-dimethylcyclohexen-1-yl)oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H28OSi/c1-6-16(7-2,8-3)15-13-9-11-14(4,5)12-10-13/h9H,6-8,10-12H2,1-5H3 |
| InChIKey | URTXPHNXXCGGFH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|