C29H50OSi — CID 101201508
[4-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-8-methylnon-7-en-2-yn-4-yl]oxy-triethylsilane (PubChem CID 101201508) has the molecular formula C29H50OSi and a molecular weight of 442.80 g/mol. Its IUPAC name is [4-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-8-methylnon-7-en-2-yn-4-yl]oxy-triethylsilane.
| Compound Name | [4-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-8-methylnon-7-en-2-yn-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 101201508 |
| Molecular Formula | C29H50OSi |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | [4-[2-[(1R,5R)-2-ethenyl-1-methyl-5-propan-2-ylcyclopent-2-en-1-yl]ethyl]-8-methylnon-7-en-2-yn-4-yl]oxy-triethylsilane |
| SMILES | C=CC1=CC[C@H](C(C)C)[C@@]1(C)CCC(C#CC)(CCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H50OSi/c1-11-20-29(21-16-17-24(6)7,30-31(13-3,14-4)15-5)23-22-28(10)26(12-2)18-19-27(28)25(8)9/h12,17-18,25,27H,2,13-16,19,21-23H2,1,3-10H3/t27-,28+,29?/m1/s1 |
| InChIKey | JVAUGGMZHNPZOL-PEIRWHMSSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|