C24H34O5S — CID 101201530
(3S,4S,6R)-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-6-phenylmethoxyoctane-2,4-diol (PubChem CID 101201530) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is (3S,4S,6R)-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-6-phenylmethoxyoctane-2,4-diol.
| Compound Name | (3S,4S,6R)-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-6-phenylmethoxyoctane-2,4-diol |
|---|---|
| PubChem CID | 101201530 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3S,4S,6R)-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-6-phenylmethoxyoctane-2,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]([C@@H](O)C[C@@H](OCc2ccccc2)C(C)C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C24H34O5S/c1-17(2)22(29-16-19-9-7-6-8-10-19)15-21(25)23(24(4,5)26)30(27,28)20-13-11-18(3)12-14-20/h6-14,17,21-23,25-26H,15-16H2,1-5H3/t21-,22+,23-/m0/s1 |
| InChIKey | NETYHCCCJCRQBP-ZRBLBEILSA-N |
| XLogP | 3.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |