C29H36O5S — CID 101201533
(3S,4S,6S)-2-methyl-3-(4-methylphenyl)sulfonyl-8-phenyl-6-phenylmethoxyoctane-2,4-diol (PubChem CID 101201533) has the molecular formula C29H36O5S and a molecular weight of 496.67 g/mol. Its IUPAC name is (3S,4S,6S)-2-methyl-3-(4-methylphenyl)sulfonyl-8-phenyl-6-phenylmethoxyoctane-2,4-diol.
| Compound Name | (3S,4S,6S)-2-methyl-3-(4-methylphenyl)sulfonyl-8-phenyl-6-phenylmethoxyoctane-2,4-diol |
|---|---|
| PubChem CID | 101201533 |
| Molecular Formula | C29H36O5S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (3S,4S,6S)-2-methyl-3-(4-methylphenyl)sulfonyl-8-phenyl-6-phenylmethoxyoctane-2,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]([C@@H](O)C[C@H](CCc2ccccc2)OCc2ccccc2)C(C)(C)O)cc1 |
| InChI | InChI=1S/C29H36O5S/c1-22-14-18-26(19-15-22)35(32,33)28(29(2,3)31)27(30)20-25(17-16-23-10-6-4-7-11-23)34-21-24-12-8-5-9-13-24/h4-15,18-19,25,27-28,30-31H,16-17,20-21H2,1-3H3/t25-,27-,28-/m0/s1 |
| InChIKey | RBFUJWPLZRXOIW-MYKRZTLLSA-N |
| XLogP | 4.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |