About N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine
N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine (PubChem CID 101201539) has the molecular formula C14H30NO-
and a molecular weight of 228.40 g/mol. Its IUPAC name is N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine |
| PubChem CID | 101201539 |
| Molecular Formula | C14H30NO- |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine |
| SMILES | CCCC(C)C(N([O-])C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30NO/c1-9-10-11(2)12(13(3,4)5)15(16)14(6,7)8/h11-12H,9-10H2,1-8H3/q-1 |
| InChIKey | QHALEZBIOBVEOE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine?
The IUPAC name of N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine (CID 101201539) is N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine.
What is the SMILES notation for N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine?
The canonical SMILES for N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine is CCCC(C)C(N([O-])C(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine?
The InChIKey is QHALEZBIOBVEOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30NO/c1-9-10-11(2)12(13(3,4)5)15(16)14(6,7)8/h11-12H,9-10H2,1-8H3/q-1.
What are the key properties of N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine?
N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine has a molecular weight of 228.40 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2,4-trimethyl-N-oxidoheptan-3-amine is sourced from PubChem (CID 101201539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).