C20H34O8Si — CID 101202173
[(E,1R)-1-[(3aR,5R,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-4-oxobut-2-enyl] acetate (PubChem CID 101202173) has the molecular formula C20H34O8Si and a molecular weight of 430.57 g/mol. Its IUPAC name is [(E,1R)-1-[(3aR,5R,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-4-oxobut-2-enyl] acetate.
| Compound Name | [(E,1R)-1-[(3aR,5R,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-4-oxobut-2-enyl] acetate |
|---|---|
| PubChem CID | 101202173 |
| Molecular Formula | C20H34O8Si |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [(E,1R)-1-[(3aR,5R,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-4-oxobut-2-enyl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/C=O)[C@@]1(O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H34O8Si/c1-13(22)25-14(10-9-11-21)20(23)15(12-24-29(7,8)18(2,3)4)26-17-16(20)27-19(5,6)28-17/h9-11,14-17,23H,12H2,1-8H3/b10-9+/t14-,15-,16+,17-,20-/m1/s1 |
| InChIKey | VMJVNAHOBJJMBQ-VMHOMIMWSA-N |
| XLogP | 2.30 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|