C31H32N4O4S — CID 10120272
3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]-3-thiophen-2-ylpropanoyl]amino]propanoic acid (PubChem CID 10120272) has the molecular formula C31H32N4O4S and a molecular weight of 556.69 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]-3-thiophen-2-ylpropanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]-3-thiophen-2-ylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10120272 |
| Molecular Formula | C31H32N4O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]-3-thiophen-2-ylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@H](Cc1cccs1)NC(=O)CCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N4O4S/c36-29(12-6-18-33-28-11-4-5-17-32-28)34-27(20-25-10-7-19-40-25)31(39)35-26(21-30(37)38)24-15-13-23(14-16-24)22-8-2-1-3-9-22/h1-5,7-11,13-17,19,26-27H,6,12,18,20-21H2,(H,32,33)(H,34,36)(H,35,39)(H,37,38)/t26?,27-/m0/s1 |
| InChIKey | VOENVFOYYDMCFA-GEVKEYJPSA-N |
| XLogP | 5.06 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|