C10H11F3N2O6 — CID 101202817
(2,5-dioxopyrrolidin-1-yl) 4-[(2,2,2-trifluoroacetyl)oxyamino]butanoate (PubChem CID 101202817) has the molecular formula C10H11F3N2O6 and a molecular weight of 312.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2,2,2-trifluoroacetyl)oxyamino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2,2,2-trifluoroacetyl)oxyamino]butanoate |
|---|---|
| PubChem CID | 101202817 |
| Molecular Formula | C10H11F3N2O6 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2,2,2-trifluoroacetyl)oxyamino]butanoate |
| SMILES | O=C(CCCNOC(=O)C(F)(F)F)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H11F3N2O6/c11-10(12,13)9(19)20-14-5-1-2-8(18)21-15-6(16)3-4-7(15)17/h14H,1-5H2 |
| InChIKey | JYUBKNILIAJKPO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|