C28H26F7NO3 — CID 10120284
1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol (PubChem CID 10120284) has the molecular formula C28H26F7NO3 and a molecular weight of 557.51 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10120284 |
| Molecular Formula | C28H26F7NO3 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Oc2ccc3c(c2)CCCC3)c1)C(F)(F)F |
| InChI | InChI=1S/C28H26F7NO3/c29-26(30)28(34,35)39-24-10-3-5-18(13-24)16-36(17-25(37)27(31,32)33)21-8-4-9-22(15-21)38-23-12-11-19-6-1-2-7-20(19)14-23/h3-5,8-15,25-26,37H,1-2,6-7,16-17H2 |
| InChIKey | PAYVDVGQXAVUIO-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|