About 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one
9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one (PubChem CID 101203268) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one.
Analyze 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one?
The IUPAC name of 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one (CID 101203268) is 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one.
What is the SMILES notation for 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one?
The canonical SMILES for 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one is C=C1C=CCN2C(=O)CCCC12.
What is the InChIKey of 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one?
The InChIKey is APLQSKNNXHRXTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8-4-3-7-11-9(8)5-2-6-10(11)12/h3-4,9H,1-2,5-7H2.
What are the key properties of 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one?
9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one has a molecular weight of 163.22 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylidene-2,3,6,9a-tetrahydro-1H-quinolizin-4-one is sourced from PubChem (CID 101203268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).