About 3-ethynylpenta-1,2-dien-4-yn-1-one
3-ethynylpenta-1,2-dien-4-yn-1-one (PubChem CID 101203297) has the molecular formula C7O-2
and a molecular weight of 100.08 g/mol. Its IUPAC name is 3-ethynylpenta-1,2-dien-4-yn-1-one.
Molecular Properties
| Compound Name | 3-ethynylpenta-1,2-dien-4-yn-1-one |
| PubChem CID | 101203297 |
| Molecular Formula | C7O-2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.00 |
| IUPAC Name | 3-ethynylpenta-1,2-dien-4-yn-1-one |
| SMILES | [C-]#CC(=C=C=O)C#[C-] |
| InChI | InChI=1S/C7O/c1-3-7(4-2)5-6-8/q-2 |
| InChIKey | ZLWAIOKPYWFBFO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynylpenta-1,2-dien-4-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynylpenta-1,2-dien-4-yn-1-one?
The IUPAC name of 3-ethynylpenta-1,2-dien-4-yn-1-one (CID 101203297) is 3-ethynylpenta-1,2-dien-4-yn-1-one.
What is the SMILES notation for 3-ethynylpenta-1,2-dien-4-yn-1-one?
The canonical SMILES for 3-ethynylpenta-1,2-dien-4-yn-1-one is [C-]#CC(=C=C=O)C#[C-].
What is the InChIKey of 3-ethynylpenta-1,2-dien-4-yn-1-one?
The InChIKey is ZLWAIOKPYWFBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7O/c1-3-7(4-2)5-6-8/q-2.
What are the key properties of 3-ethynylpenta-1,2-dien-4-yn-1-one?
3-ethynylpenta-1,2-dien-4-yn-1-one has a molecular weight of 100.08 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylpenta-1,2-dien-4-yn-1-one is sourced from PubChem (CID 101203297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).