About 2-ethynylhex-1-en-3,5-diyn-1-one
2-ethynylhex-1-en-3,5-diyn-1-one (PubChem CID 101203305) has the molecular formula C8H2O
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-ethynylhex-1-en-3,5-diyn-1-one.
Molecular Properties
| Compound Name | 2-ethynylhex-1-en-3,5-diyn-1-one |
| PubChem CID | 101203305 |
| Molecular Formula | C8H2O |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.01 |
| IUPAC Name | 2-ethynylhex-1-en-3,5-diyn-1-one |
| SMILES | C#CC#CC(=C=O)C#C |
| InChI | InChI=1S/C8H2O/c1-3-5-6-8(4-2)7-9/h1-2H |
| InChIKey | STJDQBPFBGIMOL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylhex-1-en-3,5-diyn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylhex-1-en-3,5-diyn-1-one?
The IUPAC name of 2-ethynylhex-1-en-3,5-diyn-1-one (CID 101203305) is 2-ethynylhex-1-en-3,5-diyn-1-one.
What is the SMILES notation for 2-ethynylhex-1-en-3,5-diyn-1-one?
The canonical SMILES for 2-ethynylhex-1-en-3,5-diyn-1-one is C#CC#CC(=C=O)C#C.
What is the InChIKey of 2-ethynylhex-1-en-3,5-diyn-1-one?
The InChIKey is STJDQBPFBGIMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2O/c1-3-5-6-8(4-2)7-9/h1-2H.
What are the key properties of 2-ethynylhex-1-en-3,5-diyn-1-one?
2-ethynylhex-1-en-3,5-diyn-1-one has a molecular weight of 114.10 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylhex-1-en-3,5-diyn-1-one is sourced from PubChem (CID 101203305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).