C67H62N2O3 — CID 101203421
2,6-bis[[(2R)-2-[hydroxy-bis(2-phenylphenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphenol (PubChem CID 101203421) has the molecular formula C67H62N2O3 and a molecular weight of 943.24 g/mol. Its IUPAC name is 2,6-bis[[(2R)-2-[hydroxy-bis(2-phenylphenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(2R)-2-[hydroxy-bis(2-phenylphenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 101203421 |
| Molecular Formula | C67H62N2O3 |
| Molecular Weight | 943.24 g/mol |
| Exact Mass | 942.48 |
| IUPAC Name | 2,6-bis[[(2R)-2-[hydroxy-bis(2-phenylphenyl)methyl]pyrrolidin-1-yl]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN2CCC[C@@H]2C(O)(c2ccccc2-c2ccccc2)c2ccccc2-c2ccccc2)c(O)c(CN2CCC[C@@H]2C(O)(c2ccccc2-c2ccccc2)c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C67H62N2O3/c1-48-44-53(46-68-42-22-40-63(68)66(71,59-36-18-14-32-55(59)49-24-6-2-7-25-49)60-37-19-15-33-56(60)50-26-8-3-9-27-50)65(70)54(45-48)47-69-43-23-41-64(69)67(72,61-38-20-16-34-57(61)51-28-10-4-11-29-51)62-39-21-17-35-58(62)52-30-12-5-13-31-52/h2-21,24-39,44-45,63-64,70-72H,22-23,40-43,46-47H2,1H3/t63-,64-/m1/s1 |
| InChIKey | PYOIZYBOSMVYJN-CEOZETRISA-N |
| XLogP | 14.17 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.24 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|