About [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane
[(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane (PubChem CID 101203636) has the molecular formula C15H31BrOSi
and a molecular weight of 335.40 g/mol. Its IUPAC name is [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 101203636 |
| Molecular Formula | C15H31BrOSi |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC/C(=C/[C@H](C)CCO[Si](C)(C)C(C)(C)C)CBr |
| InChI | InChI=1S/C15H31BrOSi/c1-8-14(12-16)11-13(2)9-10-17-18(6,7)15(3,4)5/h11,13H,8-10,12H2,1-7H3/b14-11-/t13-/m1/s1 |
| InChIKey | ZWYBJUOOFHRNNR-KECPUOCWSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane (CID 101203636) is [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane is CC/C(=C/[C@H](C)CCO[Si](C)(C)C(C)(C)C)CBr.
What is the InChIKey of [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane?
The InChIKey is ZWYBJUOOFHRNNR-KECPUOCWSA-N. The full InChI is InChI=1S/C15H31BrOSi/c1-8-14(12-16)11-13(2)9-10-17-18(6,7)15(3,4)5/h11,13H,8-10,12H2,1-7H3/b14-11-/t13-/m1/s1.
What are the key properties of [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane?
[(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane has a molecular weight of 335.40 g/mol, XLogP of 5.77, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,3R)-5-(bromomethyl)-3-methylhept-4-enoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 101203636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).