C20H40O3Si — CID 101204275
(E,2R,4S,5S)-5-hydroxy-2,4,6-trimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-3-one (PubChem CID 101204275) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is (E,2R,4S,5S)-5-hydroxy-2,4,6-trimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-3-one.
| Compound Name | (E,2R,4S,5S)-5-hydroxy-2,4,6-trimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-3-one |
|---|---|
| PubChem CID | 101204275 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (E,2R,4S,5S)-5-hydroxy-2,4,6-trimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-3-one |
| SMILES | C/C=C(\C)[C@@H](O)[C@H](C)C(=O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-11-16(8)19(21)18(10)20(22)17(9)12-23-24(13(2)3,14(4)5)15(6)7/h11,13-15,17-19,21H,12H2,1-10H3/b16-11+/t17-,18+,19-/m1/s1 |
| InChIKey | BRVXMDSWYKJCLX-VFSDAXNYSA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|